Compound Q&A

What is the market or research trend for N'-[(2S,3S)-2-(Benzyloxy)-3-pentanyl]formic hydrazide ethanedioate (CAS: 1887197-42-3)?

Answer

N'-[(2S,3S)-2-(Benzyloxy)-3-pentanyl]formic hydrazide ethanedioate (1:1)
The market and research trends for N'-[(2S,3S)-2-(Benzyloxy)-3-pentanyl]formic hydrazide ethanedioate (CAS: 1887197-42-3) are focused on its potential applications in medicinal chemistry and materials science. Emerging research fields include drug discovery and development, as well as novel synthetic methods and properties exploration. The demand is growing due to its unique chemical properties and potential in various applications.

About

English Name N'-[(2S,3S)-2-(Benzyloxy)-3-pentanyl]formic hydrazide ethanedioate (1:1)
Molecular Formula C15H22N2O6
Molecular Weight 326.35 g/mol
SMILES CC[C@@H]([C@H](C)OCc1ccccc1)NNC=O.C(=O)(C(=O)O)O
InChIKey NHBNQZOZYCCDJW-JZKFLRDJSA-N
Last Updated: 2025-10-23 17:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to N'-[(2S,3S)-2-(Benzyloxy)-3-pentanyl]formic hydrazide ethanedioate (CAS: 1887197-42-3)?

N'-[(2S,3S)-2-(Benzyloxy)-3-pentanyl]formic hydrazide ethanedioate (CAS: 1887197-42-3) is subject to...

Compound Q&A

Are there alternatives to N'-[(2S,3S)-2-(Benzyloxy)-3-pentanyl]formic hydrazide ethanedioate (CAS: 1887197-42-3) in synthesis?

There are several alternatives to N'-[(2S,3S)-2-(Benzyloxy)-3-pentan-1-yl]formic hydrazide ethanedio...

Compound Q&A

How should waste containing N'-[(2S,3S)-2-(Benzyloxy)-3-pentanyl]formic hydrazide ethanedioate (CAS: 1887197-42-3) be handled?

Waste containing N'-[(2S,3S)-2-(Benzyloxy)-3-pentan-1-yl]formic hydrazide ethanedioate (CAS: 1887197...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...