Compound Q&A

Are there alternatives to 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) in synthesis?

Answer

2,6-Dichloro-3-fluorobenzoic acid
There are alternative reagents that can be used in place of 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) depending on the specific reaction conditions. For example, 2,6-Dichloro-3-fluorobenzenesulfonic acid can be a suitable substitute in some cases. However, the choice of alternative depends on the desired product and the reaction conditions.

About

English Name 2,6-Dichloro-3-fluorobenzoic acid
Molecular Formula C7H3Cl2FO2
Molecular Weight 209 g/mol
SMILES C1=CC(=C(C(=C1F)Cl)C(=O)O)Cl
InChIKey NMFMJSSFYLXQAO-UHFFFAOYSA-N
Last Updated: 2025-10-23 12:19

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0)?

2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) is regulated under the Global Harmonized System...

Compound Q&A

What is the market or research trend for 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0)?

The market for 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) is primarily driven by its appli...

Compound Q&A

How should waste containing 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) be handled?

Waste containing 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) should be collected in a seale...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...