Compound Q&A

Are there alternatives to 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) in synthesis?

Answer

2,6-Dichloro-3-fluorobenzoic acid
There are alternative reagents that can be used in place of 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) depending on the specific reaction conditions. For example, 2,6-Dichloro-3-fluorobenzenesulfonic acid can be a suitable substitute in some cases. However, the choice of alternative depends on the desired product and the reaction conditions.

About

English Name 2,6-Dichloro-3-fluorobenzoic acid
Molecular Formula C7H3Cl2FO2
Molecular Weight 209.003 g/mol
SMILES C1=CC(=C(C(=C1F)Cl)C(=O)O)Cl
InChIKey NMFMJSSFYLXQAO-UHFFFAOYSA-N
Last Updated: 2025-10-23 12:19

Related Q&A

Compound Q&A

What regulatory guidelines apply to 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0)?

2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) is regulated under the Global Harmonized System...

Compound Q&A

What is the market or research trend for 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0)?

The market for 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) is primarily driven by its appli...

Compound Q&A

How should waste containing 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) be handled?

Waste containing 2,6-Dichloro-3-fluorobenzoic acid (CAS: 178813-78-0) should be collected in a seale...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...