Compound Q&A

What are the physical and chemical properties of 4-Bromo-2,6-dimethylbenzoic acid (CAS: 74346-19-3)?

Answer

4-Bromo-2,6-dimethylbenzoic acid
4-Bromo-2,6-dimethylbenzoic acid is a crystalline solid with a molecular weight of approximately 240.03 g/mol. It has a low water solubility and is slightly soluble in common organic solvents like ethanol and acetone. The compound is known for its reactivity, particularly towards nucleophilic aromatic substitution and esterification reactions.

About

CAS No 74346-19-3
English Name 4-Bromo-2,6-dimethylbenzoic acid
Molecular Formula C9H9BrO2
Molecular Weight 229.07 g/mol
SMILES CC1=CC(=CC(=C1C(=O)O)C)Br
InChIKey DJZAABLAECNINV-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 4-Bromo-2,6-dimethylbenzoic acid (CAS: 74346-19-3) typically synthesized?

4-Bromo-2,6-dimethylbenzoic acid is commonly synthesized via bromination of 2,6-dimethylbenzoic acid...

Compound Q&A

What industries use 4-Bromo-2,6-dimethylbenzoic acid (CAS: 74346-19-3)?

4-Bromo-2,6-dimethylbenzoic acid finds applications in the pharmaceutical industry for the synthesis...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2,6-dimethylbenzoic acid (CAS: 74346-19-3)?

When handling 4-Bromo-2,6-dimethylbenzoic acid, it is important to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...