Compound Q&A

What precautions should be taken when handling 2-Bromo-9,9-dioctyl-9H-fluorene (CAS: 302554-80-9)?

Answer

2-Bromo-9,9-dioctyl-9H-fluorene
When handling 2-Bromo-9,9-dioctyl-9H-fluorene (CAS: 302554-80-9), it is important to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. It should be stored in a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be ventilated. Always consult a safety data sheet (SDS) for specific handling instructions and emergency procedures.

About

English Name 2-Bromo-9,9-dioctyl-9H-fluorene
Molecular Formula C29H41Br
Molecular Weight 469.55 g/mol
SMILES CCCCCCCCC1(CCCCCCCC)C2=C(C3=C1C=CC=C3)C=CC(Br)=C2
InChIKey ITVGRPGDCPNGHZ-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Bromo-9,9-dioctyl-9H-fluorene (CAS: 302554-80-9)?

2-Bromo-9,9-dioctyl-9H-fluorene (CAS: 302554-80-9) is a solid with a crystalline form. It has a mole...

Compound Q&A

How is 2-Bromo-9,9-dioctyl-9H-fluorene (CAS: 302554-80-9) typically synthesized?

2-Bromo-9,9-dioctyl-9H-fluorene is typically synthesized through a bromination reaction of 9,9-dioct...

Compound Q&A

What industries use 2-Bromo-9,9-dioctyl-9H-fluorene (CAS: 302554-80-9)?

2-Bromo-9,9-dioctyl-9H-fluorene (CAS: 302554-80-9) is used in the pharmaceutical industry for the sy...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...