Compound Q&A

What industries use 1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1) (CAS: 30986-62-0)?

Answer

1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1)
1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1) finds applications in pharmaceuticals for the synthesis of certain biologically active compounds, in polymers for special properties, and in sensors for detection of specific analytes. It is also used in the development of semiconductor materials due to its unique chemical structure and functional groups.

About

CAS No 30986-62-0
English Name 1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1)
Molecular Formula C11H21N5O6S
Molecular Weight 351.39 g/mol
SMILES C1C(NC(S1)C(=O)O)C(=O)O.C(CC(C(=O)O)N)CN=C(N)N
InChIKey LUCWYYXUZVULSK-WCCKRBBISA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1) (CAS: 30986-62-0)?

1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1) has a crystalline form with a molecular we...

Compound Q&A

How is 1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1) (CAS: 30986-62-0) typically synthesized?

1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1) is typically synthesized via a multistep p...

Compound Q&A

What precautions should be taken when handling 1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1) (CAS: 30986-62-0)?

When handling 1,3-Thiazolidine-2,4-dicarboxylic acid - L-arginine (1:1), it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...