Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-methyl-4-piperidinyl)carbamate (CAS: 163271-08-7)?

Answer

2-Methyl-2-propanyl (4-methyl-4-piperidinyl)carbamate
2-Methyl-2-propanyl (4-methyl-4-piperidinyl)carbamate is a solid with a crystalline form. Its molecular weight is approximately 249.32 g/mol. It is slightly soluble in water but more soluble in organic solvents like dichloromethane and ethanol. Chemically, it is stable under normal conditions but may react with strong acids and bases. It is used in pharmaceuticals and other industries due to its unique properties.

About

English Name 2-Methyl-2-propanyl (4-methyl-4-piperidinyl)carbamate
Molecular Formula C11H22N2O2
Molecular Weight 214.31 g/mol
SMILES CC1(CCNCC1)NC(=O)OC(C)(C)C
InChIKey MVUNGZMGWJXPIM-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (4-methyl-4-piperidinyl)carbamate (CAS: 163271-08-7) typically synthesized?

2-Methyl-2-propanyl (4-methyl-4-piperidinyl)carbamate is synthesized through the reaction of 2-methy...

Compound Q&A

What industries use 2-Methyl-2-propanyl (4-methyl-4-piperidinyl)carbamate (CAS: 163271-08-7)?

2-Methyl-2-proanyl (4-methyl-4-piperidinyl)carbamate is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl (4-methyl-4-piperidinyl)carbamate (CAS: 163271-08-7)?

When handling 2-Methyl-2-proanyl (4-methyl-4-piperidinyl)carbamate, use personal protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...