Compound Q&A

What are the physical and chemical properties of Hederacolchiside E (CAS: 33783-82-3)?

Answer

Hederacolchiside E
Hederacolchiside E (CAS: 33783-82-3) is a hydroxy flavonoid. It has a crystalline form with a molecular weight of approximately 478.27 g/mol. This compound has limited solubility in water but is soluble in methanol and ethanol. It shows moderate reactivity, particularly towards base-catalyzed hydrolysis.

About

CAS No 33783-82-3
English Name Hederacolchiside E
Molecular Formula C65H106O30
Molecular Weight 1367.5 g/mol
SMILES CC1C(C(C(C(O1)OC2C(OC(C(C2O)O)OCC3C(C(C(C(O3)OC(=O)C45CCC(CC4C6=CCC7C8(CCC(C(C8CCC7(C6(CC5)C)C)(C)C)OC9C(C(C(CO9)OC1C(C(C(C(O1)CO)O)O)O)O)OC1C(C(C(C(O1)C)O)O)O)C)(C)C)O)O)O)CO)O)O)O
InChIKey DXLORNSIGDEVQK-ORHSKWSZSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Hederacolchiside E (CAS: 33783-82-3) typically synthesized?

Hederacolchiside E is typically synthesized through the glycosylation of kaempferol with sophorose u...

Compound Q&A

What industries use Hederacolchiside E (CAS: 33783-82-3)?

Hederacolchiside E (CAS: 33783-82-3) is used in the pharmaceutical industry for its potential as a n...

Compound Q&A

What precautions should be taken when handling Hederacolchiside E (CAS: 33783-82-3)?

When handling Hederacolchiside E (CAS: 33783-82-3), it is essential to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...