Compound Q&A

What are the physical and chemical properties of trans,trans-4-n-Propyl-4-[4-(trifluoromethoxy)phenyl]bicyclohexyl (CAS: 133937-72-1)?

Answer

trans,trans-4-n-Propyl-4-[4-(trifluoromethoxy)phenyl]bicyclohexyl
The compound is a crystalline solid with a high molecular weight due to the presence of trifluoromethoxy and propyl groups. It has low water solubility and good solubility in organic solvents like dichloromethane and toluene. The compound is relatively stable under normal conditions but can react with strong bases. It has a high boiling point and low volatility.

About

English Name trans,trans-4-n-Propyl-4-[4-(trifluoromethoxy)phenyl]bicyclohexyl
Molecular Formula C22H31F3O
Molecular Weight 368.48 g/mol
SMILES CCCC1CCC(CC1)C2CCC(CC2)C3=CC=C(C=C3)OC(F)(F)F
InChIKey AJQMFUYBFQQAKA-POSCCBCBSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is trans,trans-4-n-Propyl-4-[4-(trifluoromethoxy)phenyl]bicyclohexyl (CAS: 133937-72-1) typically synthesized?

The compound is commonly synthesized via a multistep process involving the formation of a bicyclic i...

Compound Q&A

What industries use trans,trans-4-n-Propyl-4-[4-(trifluoromethoxy)phenyl]bicyclohexyl (CAS: 133937-72-1)?

This compound is primarily used in the pharmaceutical industry for its potential as a medicinal agen...

Compound Q&A

What precautions should be taken when handling trans,trans-4-n-Propyl-4-[4-(trifluoromethoxy)phenyl]bicyclohexyl (CAS: 133937-72-1)?

Proper personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat should be ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...