Compound Q&A

What industries use (2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS: 38963-95-0)?

Answer

(2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
The compound is used in the pharmaceutical industry for its potential therapeutic applications, particularly in the development of drugs targeting specific enzymes. It is also utilized in the production of advanced polymers for biomedical applications and in the development of sensors for detecting specific chemical compounds.

About

CAS No 38963-95-0
English Name (2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Molecular Formula C20H22O8
Molecular Weight 390.38800000000003 g/mol
SMILES OC[C@H]1O[C@@H](OC2=CC=C(\C=C\C3=CC(O)=CC(O)=C3)C=C2)[C@H](O)[C@@H](O)[C@@H]1O
InChIKey RUOKEYJFAJITAG-CUYWLFDKSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS: 38963-95-0)?

The compound has a crystalline form with a molecular weight of approximately 456.39 g/mol. It is sli...

Compound Q&A

How is (2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS: 38963-95-0) typically synthesized?

This compound is typically synthesized via a multistep process involving the coupling of a phenolic ...

Compound Q&A

What precautions should be taken when handling (2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS: 38963-95-0)?

When handling this compound, appropriate personal protective equipment (PPE) such as gloves, goggles...

Compound Q&A

How is hexyl(diphenyl)phosphine (CAS: 18298-00-5) typically synthesized?

Hexyl(diphenyl)phosphine is typically synthesized by the reaction of hexylmagnes...

18298-00-5Hexyl(diphenyl)phosp...
Compound Q&A

How should 2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) be stored?

2-Methyl-2-proanyl 3-amino-2-methyl-1-azetidinecarboxylate (CAS: 1368087-42-6) s...

1368087-42-62-Methyl-2-propanyl ...
Compound Q&A

What are the main uses of 4-(1-Pyrrolidinyl)aniline hydrochloride (CAS: 216670-47-2)?

4-(1-Pyrrolidinyl)aniline hydrochloride is primarily used as a raw material in p...

216670-47-24-(1-Pyrrolidinyl)an...
Compound Q&A

What industries use Tetraphenylthiophene (CAS: 1884-68-0)?

Tetraphenylthiophene (CAS: 1884-68-0) is used in various industries. It is a key...

1884-68-0Tetraphenylthiophene