Compound Q&A

What industries use 2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone (CAS: 5284-79-7)?

Answer

2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone
2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone is used in the pharmaceutical industry for the synthesis of complex organic molecules, in polymer science for functional monomers, and in sensor technology for the development of specialized detection systems. It also has applications in semiconductor technology for organic electronics.

About

CAS No 5284-79-7
English Name 2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone
Molecular Formula C21H18N6O
Molecular Weight 370.4 g/mol
SMILES CC1CC(=CC2=CC=C(C=C2)N=[N+]=[N-])C(=O)C(=CC3=CC=C(C=C3)N=[N+]=[N-])C1
InChIKey MLIWQXBKMZNZNF-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone (CAS: 5284-79-7)?

2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone is a crystalline compound with a molecular weight ...

Compound Q&A

How is 2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone (CAS: 5284-79-7) typically synthesized?

2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone is usually synthesized through a multi-step proces...

Compound Q&A

What precautions should be taken when handling 2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone (CAS: 5284-79-7)?

When handling 2,6-Bis(4-azidobenzylidene)-4-methylcyclohexanone, appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...