Compound Q&A

What are the physical and chemical properties of N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1) (CAS: 26914-52-3)?

Answer

N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1)
N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1) is a crystalline solid with a molecular weight of approximately 262.30 g/mol. It has a low solubility in water but is soluble in organic solvents. This compound is relatively stable under normal conditions but may react with strong acids or bases. It is used in various applications requiring its specific chemical reactivity.

About

CAS No 26914-52-3
English Name N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1)
Molecular Formula C18H26N2O4S2
Molecular Weight 398.55 g/mol
SMILES CCNS(=O)(=O)C1=CC=C(C=C1)C.CCNS(=O)(=O)C1=CC=CC=C1C
InChIKey IDLSDSKPHLCUTN-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1) (CAS: 26914-52-3) typically synthesized?

N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1) is typically synthesiz...

Compound Q&A

What industries use N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1) (CAS: 26914-52-3)?

N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1) is primarily used in t...

Compound Q&A

What precautions should be taken when handling N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1) (CAS: 26914-52-3)?

When handling N-Ethyl-2-methylbenzenesulfonamide - N-ethyl-4-methylbenzenesulfonamide (1:1), it is e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...