Compound Q&A

What industries use 1,1'-Sulfanediylbis(4-bromobenzene) (CAS: 3393-78-0)?

Answer

1,1'-Sulfanediylbis(4-bromobenzene)
1,1'-Sulfanediylbis(4-bromobenzene) (CAS: 3393-78-0) is used in the pharmaceutical industry for the synthesis of complex organic molecules, particularly in the development of certain types of drugs. It is also utilized in the polymer industry as a precursor for the synthesis of specialty polymers with unique properties. Additionally, it has applications in the semiconductor industry for the fabrication of microelectronic devices and in sensor technology for its high reactivity and specific chemical binding properties.

About

CAS No 3393-78-0
English Name 1,1'-Sulfanediylbis(4-bromobenzene)
Molecular Formula C12H8Br2S
Molecular Weight 344.07 g/mol
SMILES C1=CC(=CC=C1SC2=CC=C(C=C2)Br)Br
InChIKey CLPVCAXOQZIJGW-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,1'-Sulfanediylbis(4-bromobenzene) (CAS: 3393-78-0)?

1,1'-Sulfanediylbis(4-bromobenzene) (CAS: 3393-78-0) is a crystalline solid with a molecular weight ...

Compound Q&A

How is 1,1'-Sulfanediylbis(4-bromobenzene) (CAS: 3393-78-0) typically synthesized?

1,1'-Sulfanediylbis(4-bromobenzene) (CAS: 3393-78-0) is typically synthesized via a Grignard reactio...

Compound Q&A

What precautions should be taken when handling 1,1'-Sulfanediylbis(4-bromobenzene) (CAS: 3393-78-0)?

When handling 1,1'-Sulfanediylbis(4-bromobenzene) (CAS: 3393-78-0), safety is paramount. It should b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...