Compound Q&A

What are the physical and chemical properties of Benzoic acid, calcium salt (2:1) (CAS: 2090-05-3)?

Answer

Benzoic acid, calcium salt (2:1)
Benzoic acid, calcium salt (2:1) is a white, crystalline solid with a molecular weight of approximately 224.24 g/mol. It is sparingly soluble in water but soluble in ethanol. The salt is relatively stable and exhibits weak acidity. It reacts with bases to form benzoate salts and can undergo esterification reactions.

About

CAS No 2090-05-3
English Name Benzoic acid, calcium salt (2:1)
Molecular Formula C14H10CaO4
Molecular Weight 282.3 g/mol
SMILES [O-]C(=O)c1ccccc1.[O-]C(=O)c1ccccc1.[Ca+2]
InChIKey NSQPPSOSXWOZNH-UHFFFAOYSA-L
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Benzoic acid, calcium salt (2:1) (CAS: 2090-05-3) typically synthesized?

Benzoic acid, calcium salt (2:1) is typically synthesized by reacting benzoic acid with calcium hydr...

Compound Q&A

What industries use Benzoic acid, calcium salt (2:1) (CAS: 2090-05-3)?

Benzoic acid, calcium salt (2:1) is used in the pharmaceutical industry as a preservative, in the fo...

Compound Q&A

What precautions should be taken when handling Benzoic acid, calcium salt (2:1) (CAS: 2090-05-3)?

When handling Benzoic acid, calcium salt (2:1), appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...