Compound Q&A

What are the physical and chemical properties of (3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole (CAS: 90084-43-8)?

Answer

(3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole
The compound (3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole has a crystalline form and a molecular weight of approximately 184.24 g/mol. It is slightly soluble in common organic solvents like methanol and ether. The compound shows good reactivity towards nucleophiles, particularly in organoboron coupling reactions. It is stable under normal laboratory conditions but may decompose at high temperatures.

About

CAS No 90084-43-8
English Name (3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole
Molecular Formula C10H17BO2
Molecular Weight 180.06 g/mol
SMILES CC1(C)[C@@H]2C[C@@H]3[C@@]([C@H]1C2)(C)OBO3
InChIKey IMQDCOPICJMJPI-OORONAJNSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is (3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole (CAS: 90084-43-8) typically synthesized?

This compound is commonly synthesized through a multistep process involving the preparation of a sui...

Compound Q&A

What industries use (3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole (CAS: 90084-43-8)?

This compound finds application in the pharmaceutical industry for the synthesis of complex molecule...

Compound Q&A

What precautions should be taken when handling (3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole (CAS: 90084-43-8)?

When handling (3AS,4S,6S,7aR)-3a,5,5-trimethylhexahydro-4,6-methanobenzo[d][1,3,2]dioxaborole, it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...