Compound Q&A

What precautions should be taken when handling 4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid (CAS: 1245823-51-1)?

Answer

4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid
When handling 4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid, it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from heat sources. In case of a spill, it should be handled in a fume hood, and the appropriate safety data sheet (SDS) should be consulted for detailed instructions.

About

English Name 4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid
Molecular Formula C14H24O7
Molecular Weight 294.34 g/mol
SMILES OC(=O)CCOCCOCCOCCOCCOCC#C
InChIKey GWIACWQVTBMVEI-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid (CAS: 1245823-51-1)?

4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid is a crystalline solid with a molecular weight of appr...

Compound Q&A

How is 4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid (CAS: 1245823-51-1) typically synthesized?

4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid can be synthesized via cycloaddition reactions, specif...

Compound Q&A

What industries use 4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid (CAS: 1245823-51-1)?

4,7,10,13,16-Pentaoxanonadec-18-yn-1-oic acid is primarily used in the pharmaceutical industry for t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...