Compound Q&A

What are the physical and chemical properties of BOC-ALA-NH2 (CAS: 85642-13-3)?

Answer

BOC-ALA-NH2
BOC-ALA-NH2 (CAS: 85642-13-3) is a white to off-white solid with a molecular weight of approximately 279.35 g/mol. It has a high solubility in organic solvents such as DMSO and DMF but is poorly soluble in water. The compound is relatively stable under normal conditions but can react with acids to release the BOC group. It exhibits good reactivity in amide formation reactions.

About

CAS No 85642-13-3
English Name BOC-ALA-NH2
Molecular Formula C8H16N2O3
Molecular Weight 188.23 g/mol
SMILES C[C@H](NC(=O)OC(C)(C)C)C(=O)N
InChIKey GZKKSKKIABUUCX-YFKPBYRVSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is BOC-ALA-NH2 (CAS: 85642-13-3) typically synthesized?

BOC-ALA-NH2 (CAS: 85642-13-3) is typically synthesized by the amidation of L-alanine with an N-hydro...

Compound Q&A

What industries use BOC-ALA-NH2 (CAS: 85642-13-3)?

BOC-ALA-NH2 (CAS: 85642-13-3) is primarily used in the pharmaceutical and biotechnology industries f...

Compound Q&A

What precautions should be taken when handling BOC-ALA-NH2 (CAS: 85642-13-3)?

When handling BOC-ALA-NH2 (CAS: 85642-13-3), appropriate Personal Protective Equipment (PPE) such as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...