Compound Q&A

What are the physical and chemical properties of (2S,5R,6R)-6-{[(2R)-2-Carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 34787-01-4)?

Answer

(2S,5R,6R)-6-{[(2R)-2-Carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
This compound is a white or off-white crystalline solid. Its molecular weight is approximately 422.27 g/mol. It is slightly soluble in water and organic solvents. It is reactive towards nucleophiles due to its carboxylic acid and thienyl acetyl groups. The compound is stable under normal conditions but should be stored in a dry environment to prevent hydrolysis.

About

CAS No 34787-01-4
English Name (2S,5R,6R)-6-{[(2R)-2-Carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid
Molecular Formula C15H16N2O6S2
Molecular Weight 384.44 g/mol
SMILES CC1(C(N2C(S1)C(C2=O)NC(=O)C(C3=CSC=C3)C(=O)O)C(=O)O)C
InChIKey OHKOGUYZJXTSFX-KZFFXBSXSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is (2S,5R,6R)-6-{[(2R)-2-Carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 34787-01-4) typically synthesized?

The compound is typically synthesized via the condensation of 2-(3-thienyl)acetic acid and 2-amino-3...

Compound Q&A

What industries use (2S,5R,6R)-6-{[(2R)-2-Carboxy-2-(3-thienyl)acetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS: 34787-01-4)?

This compound finds application in the pharmaceutical industry for its potential use as a drug inter...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...