Compound Q&A

What are the physical and chemical properties of Tris(2,2,2-trifluoroethyl) borate (CAS: 659-18-7)?

Answer

Tris(2,2,2-trifluoroethyl) borate
Tris(2,2,2-trifluoroethyl) borate (CAS: 659-18-7) is a colorless or white crystalline solid with a molecular weight of approximately 312.04 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. This compound is reactive towards strong acids and bases. It does not typically react with reducing agents or oxidizers under normal conditions.

About

CAS No 659-18-7
English Name Tris(2,2,2-trifluoroethyl) borate
Molecular Formula C6H6BF9O3
Molecular Weight 307.9 g/mol
SMILES FC(F)(F)COB(OCC(F)(F)F)OCC(F)(F)F
InChIKey DIEXQJFSUBBIRP-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is Tris(2,2,2-trifluoroethyl) borate (CAS: 659-18-7) typically synthesized?

Tris(2,2,2-trifluoroethyl) borate (CAS: 659-18-7) is typically synthesized by the reaction of tris(2...

Compound Q&A

What industries use Tris(2,2,2-trifluoroethyl) borate (CAS: 659-18-7)?

Tris(2,2,2-trifluoroethyl) borate (CAS: 659-18-7) is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling Tris(2,2,2-trifluoroethyl) borate (CAS: 659-18-7)?

When handling Tris(2,2,2-trifluoroethyl) borate (CAS: 659-18-7), it is important to use proper perso...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...