Compound Q&A

What precautions should be taken when handling 4,4'-(4-Methyl-2,2-pentanediyl)diphenol (CAS: 6807-17-6)?

Answer

4,4'-(4-Methyl-2,2-pentanediyl)diphenol
When handling 4,4'-(4-Methyl-2,2-pentanediyl)diphenol, proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The compound should be stored in a cool, dry place away from direct sunlight and heat sources. Use a fume hood during handling to minimize inhalation risks. In case of spills, use appropriate containment and disposal methods as outlined in the Safety Data Sheet (SDS).

About

CAS No 6807-17-6
English Name 4,4'-(4-Methyl-2,2-pentanediyl)diphenol
Molecular Formula C18H22O2
Molecular Weight 270.37 g/mol
SMILES CC(C)CC(C)(C1=CC=C(C=C1)O)C2=CC=C(C=C2)O
InChIKey VHLLJTHDWPAQEM-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-(4-Methyl-2,2-pentanediyl)diphenol (CAS: 6807-17-6)?

4,4'-(4-Methyl-2,2-pentanediyl)diphenol is a white crystalline solid with a molecular weight of appr...

Compound Q&A

How is 4,4'-(4-Methyl-2,2-pentanediyl)diphenol (CAS: 6807-17-6) typically synthesized?

4,4'-(4-Methyl-2,2-pentanediyl)diphenol is typically synthesized via the condensation of 4,4'-dihydr...

Compound Q&A

What industries use 4,4'-(4-Methyl-2,2-pentanediyl)diphenol (CAS: 6807-17-6)?

4,4'-(4-Methyl-2,2-pentanediyl)diphenol is used in various industries, including pharmaceuticals, wh...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...