Compound Q&A

What are the physical and chemical properties of 3-Cyano-4-fluorobenzoic acid (CAS: 171050-06-9)?

Answer

3-Cyano-4-fluorobenzoic acid
3-Cyano-4-fluorobenzoic acid is a crystalline compound with a molecular weight of 172.04 g/mol. It has a high solubility in polar solvents such as water and ethanol. The compound is moderately reactive towards nucleophiles and can undergo various synthetic transformations. It is slightly acidic and can form salts with bases.

About

English Name 3-Cyano-4-fluorobenzoic acid
Molecular Formula C8H4FNO2
Molecular Weight 165.12 g/mol
SMILES C1=CC(=C(C=C1C(=O)O)C#N)F
InChIKey JMHGATOBRPWPBZ-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 3-Cyano-4-fluorobenzoic acid (CAS: 171050-06-9) typically synthesized?

3-Cyano-4-fluorobenzoic acid can be synthesized through the reaction of 4-fluorobenzoic acid and acy...

Compound Q&A

What industries use 3-Cyano-4-fluorobenzoic acid (CAS: 171050-06-9)?

3-Cyano-4-fluorobenzoic acid is used in the pharmaceutical industry for intermediate synthesis, in t...

Compound Q&A

What precautions should be taken when handling 3-Cyano-4-fluorobenzoic acid (CAS: 171050-06-9)?

When handling 3-Cyano-4-fluorobenzoic acid, it is important to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...