Compound Q&A

What precautions should be taken when handling (Bromoethynyl)triisopropylsilane (CAS: 111409-79-1)?

Answer

(Bromoethynyl)triisopropylsilane
When handling (Bromoethynyl)triisopropylsilane, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or fume hood. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency response procedures.

About

English Name (Bromoethynyl)triisopropylsilane
Molecular Formula C11H21BrSi
Molecular Weight 261.27 g/mol
SMILES CC(C)[Si](C#CBr)(C(C)C)C(C)C
InChIKey HNNUBQWDWJNURV-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of (Bromoethynyl)triisopropylsilane (CAS: 111409-79-1)?

(Bromoethynyl)triisopropylsilane is a colorless liquid with a molecular weight of approximately 316....

Compound Q&A

How is (Bromoethynyl)triisopropylsilane (CAS: 111409-79-1) typically synthesized?

(Bromoethynyl)triisopropylsilane is usually synthesized via a reaction between triisopropylsilane an...

Compound Q&A

What industries use (Bromoethynyl)triisopropylsilane (CAS: 111409-79-1)?

(Bromoethynyl)triisopropylsilane is employed in the pharmaceuticals industry for the synthesis of ce...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...