Compound Q&A

What are the physical and chemical properties of Octylferrocene (CAS: 51889-44-2)?

Answer

Octylferrocene
Octylferrocene (CAS: 51889-44-2) is a yellow crystalline solid with a molecular weight of approximately 236.29 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and toluene. Octylferrocene is relatively stable but can undergo oxidation under certain conditions. It is used in organometallic chemistry and as an electron donor in catalysis.

About

CAS No 51889-44-2
English Name Octylferrocene
Molecular Formula C18H26Fe
Molecular Weight 298.2 g/mol
SMILES CCCCCCCC[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe]
InChIKey DRTCLTAOSAKXCN-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is Octylferrocene (CAS: 51889-44-2) typically synthesized?

Octylferrocene (CAS: 51889-44-2) is typically synthesized by the alkylation of ferrocene with n-octy...

Compound Q&A

What industries use Octylferrocene (CAS: 51889-44-2)?

Octylferrocene (CAS: 51889-44-2) finds application in various industries. It is used as a ligand in ...

Compound Q&A

What precautions should be taken when handling Octylferrocene (CAS: 51889-44-2)?

When handling Octylferrocene (CAS: 51889-44-2), it is important to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...