Compound Q&A

How is 9-Ethyl-3-nitro-9H-carbazole (CAS: 86-20-4) typically synthesized?

Answer

9-Ethyl-3-nitro-9H-carbazole
9-Ethyl-3-nitro-9H-carbazole is typically synthesized via the nitration of 9-ethyl-9H-carbazole followed by amination. Commonly, the nitration step involves the use of nitric acid and sulfuric acid as catalysts. The amination step often uses an appropriate amine under basic conditions. The yield and selectivity of the reaction can be controlled by optimizing reaction conditions such as temperature and catalyst choice.

About

CAS No 86-20-4
English Name 9-Ethyl-3-nitro-9H-carbazole
Molecular Formula C14H12N2O2
Molecular Weight 240.26 g/mol
SMILES CCN1C2=C(C=C(C=C2)[N+](=O)[O-])C3=CC=CC=C31
InChIKey WONHLSYSHMRRGO-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9-Ethyl-3-nitro-9H-carbazole (CAS: 86-20-4)?

9-Ethyl-3-nitro-9H-carbazole is a crystalline solid with a molecular weight of approximately 236.17 ...

Compound Q&A

What industries use 9-Ethyl-3-nitro-9H-carbazole (CAS: 86-20-4)?

9-Ethyl-3-nitro-9H-carbazole finds applications in various industries. In pharmaceuticals, it can be...

Compound Q&A

What precautions should be taken when handling 9-Ethyl-3-nitro-9H-carbazole (CAS: 86-20-4)?

When handling 9-Ethyl-3-nitro-9H-carbazole, it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...