Compound Q&A

What are the physical and chemical properties of o-(Trifluoromethyl)phenethyl alcohol (CAS: 94022-96-5)?

Answer

o-(Trifluoromethyl)phenethyl alcohol
o-(Trifluoromethyl)phenethyl alcohol (CAS: 94022-96-5) is a colorless liquid with a molecular weight of approximately 217.12 g/mol. It has a high boiling point of around 160°C and a low solubility in water. The compound is reactive towards acidic conditions and can undergo esterification and other functional group transformations.

About

CAS No 94022-96-5
English Name o-(Trifluoromethyl)phenethyl alcohol
Molecular Formula C9H9F3O
Molecular Weight 190.16 g/mol
SMILES C1=CC=C(C(=C1)CCO)C(F)(F)F
InChIKey DBKIEXOOUXQPGC-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is o-(Trifluoromethyl)phenethyl alcohol (CAS: 94022-96-5) typically synthesized?

o-(Trifluoromethyl)phenethyl alcohol can be synthesized by reacting trifluoromethylated phenylacetyl...

Compound Q&A

What industries use o-(Trifluoromethyl)phenethyl alcohol (CAS: 94022-96-5)?

o-(Trifluoromethyl)phenethyl alcohol (CAS: 94022-96-5) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling o-(Trifluoromethyl)phenethyl alcohol (CAS: 94022-96-5)?

When handling o-(Trifluoromethyl)phenethyl alcohol (CAS: 94022-96-5), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...