Compound Q&A

What are the physical and chemical properties of 2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane (CAS: 6166-86-5)?

Answer

2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane
2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane is a crystalline solid with a molecular weight of approximately 602.5 g/mol. It is poorly soluble in water but soluble in organic solvents. Chemically, it is stable under normal conditions but requires caution in oxidizing environments. It shows no significant reactivity under ambient conditions.

About

CAS No 6166-86-5
English Name 2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane
Molecular Formula C5H20O5Si5
Molecular Weight 300.64 g/mol
SMILES C[SiH]1O[SiH](O[SiH](O[SiH](O[SiH](O1)C)C)C)C
InChIKey HGPDWMTUQRNTQT-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane (CAS: 6166-86-5) typically synthesized?

2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane is synthesized through a complex mu...

Compound Q&A

What industries use 2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane (CAS: 6166-86-5)?

2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane (CAS: 6166-86-5)?

When handling 2,4,6,8,10-Pentamethyl-1,3,5,7,9,2,4,6,8,10-pentoxapentasilecane, it is crucial to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...