Compound Q&A

What are the physical and chemical properties of (+)-delta-Cadinene (CAS: 483-76-1)?

Answer

(+)-delta-Cadinene
The physical properties of (+)-delta-cadinene include a crystalline form with a molecular weight of approximately 214.31 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong oxidizing agents.

About

CAS No 483-76-1
English Name (+)-delta-Cadinene
Molecular Formula C15H24
Molecular Weight 204.35 g/mol
SMILES CC1=CC2C(CCC(=C2CC1)C)C(C)C
InChIKey FUCYIEXQVQJBKY-ZFWWWQNUSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is (+)-delta-Cadinene (CAS: 483-76-1) typically synthesized?

(+)-delta-Cadinene is typically synthesized via a catalytic hydrogenation of alpha-cadinol. Commonly...

Compound Q&A

What industries use (+)-delta-Cadinene (CAS: 483-76-1)?

(+)-delta-Cadinene is used in various industries. It is a key component in the production of fragran...

Compound Q&A

What precautions should be taken when handling (+)-delta-Cadinene (CAS: 483-76-1)?

When handling (+)-delta-cadinene, it is essential to wear appropriate personal protective equipment ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...