Compound Q&A

What are the physical and chemical properties of Methyl 4-methoxy-1H-indole-2-carboxylate (CAS: 111258-23-2)?

Answer

Methyl 4-methoxy-1H-indole-2-carboxylate
Methyl 4-methoxy-1H-indole-2-carboxylate is a white crystalline solid with a molecular weight of approximately 226.25 g/mol. It is soluble in solvents such as methanol and ethyl acetate. The compound is moderately reactive and can undergo ester hydrolysis under basic conditions. It has a melting point of about 140-142°C and a boiling point of around 315-317°C. Safety data sheets (SDS) should be consulted for detailed information on handling and storage.

About

English Name Methyl 4-methoxy-1H-indole-2-carboxylate
Molecular Formula C11H11NO3
Molecular Weight 205.21 g/mol
SMILES COC1=CC=CC2=C1C=C(N2)C(=O)OC
InChIKey GLCZQTLCVLVFGV-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is Methyl 4-methoxy-1H-indole-2-carboxylate (CAS: 111258-23-2) typically synthesized?

Methyl 4-methoxy-1H-indole-2-carboxylate can be synthesized via the esterification of 4-methoxy-1H-i...

Compound Q&A

What industries use Methyl 4-methoxy-1H-indole-2-carboxylate (CAS: 111258-23-2)?

Methyl 4-methoxy-1H-indole-2-carboxylate is primarily used in the pharmaceutical industry as a precu...

Compound Q&A

What precautions should be taken when handling Methyl 4-methoxy-1H-indole-2-carboxylate (CAS: 111258-23-2)?

When handling Methyl 4-methoxy-1H-indole-2-carboxylate, it is essential to wear appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...