Compound Q&A

What are the physical and chemical properties of 1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate (CAS: 174899-72-0)?

Answer

1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate
1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate is a crystalline solid with a molecular weight of approximately 347.13 g/mol. It is sparingly soluble in water but highly soluble in organic solvents. The compound is weakly basic and shows moderate reactivity with strong acids. It has good thermal stability but should be handled at room temperature to avoid decomposition.

About

English Name 1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate
Molecular Formula C8H13F3N2O3S
Molecular Weight 274.26 g/mol
SMILES CCN1C=C[N+](=C1C)C.C(F)(F)(F)S(=O)(=O)[O-]
InChIKey HMAHVRVKBSHMJX-UHFFFAOYSA-M
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate (CAS: 174899-72-0) typically synthesized?

1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate can be synthesized by reacting 1-et...

Compound Q&A

What industries use 1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate (CAS: 174899-72-0)?

1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate is used in various industries, incl...

Compound Q&A

What precautions should be taken when handling 1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate (CAS: 174899-72-0)?

Proper handling of 1-Ethyl-2,3-dimethyl-1H-imidazol-3-ium trifluoromethanesulfonate requires the use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...