Compound Q&A

What industries use 2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate (CAS: 255882-72-5)?

Answer

2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate
2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate (CAS: 255882-72-5) is used in various industries, including pharmaceuticals for the synthesis of certain drugs, and in the production of polymers where its unique chemical structure can enhance material properties. It is also utilized in the development of sensors and semiconductors due to its reactivity and stability.

About

English Name 2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate
Molecular Formula C10H17NO4
Molecular Weight 215.25 g/mol
SMILES CC(C)(C)OC(=O)N1CCC1C(=O)OC
InChIKey FGWUDHZVEBFGKS-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate (CAS: 255882-72-5)?

The compound 2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate (CAS: 255882-72-5) is a whi...

Compound Q&A

How is 2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate (CAS: 255882-72-5) typically synthesized?

2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate (CAS: 255882-72-5) is typically synthesi...

Compound Q&A

What precautions should be taken when handling 2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate (CAS: 255882-72-5)?

When handling 2-Methyl 1-(2-methyl-2-propanyl) 1,2-azetidinedicarboxylate (CAS: 255882-72-5), it is ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...