Compound Q&A

What industries use 4-Bromo-2-methyl-1-nitrobenzene (CAS: 52414-98-9)?

Answer

4-Bromo-2-methyl-1-nitrobenzene
4-Bromo-2-methyl-1-nitrobenzene (CAS: 52414-98-9) is used in the pharmaceutical industry for the synthesis of various drug intermediates, and in the polymer industry for the development of functional polymers. It also finds applications in the sensor and semiconductor industries, particularly in the preparation of derivatized compounds for specific sensing applications.

About

CAS No 52414-98-9
English Name 4-Bromo-2-methyl-1-nitrobenzene
Molecular Formula C7H6BrNO2
Molecular Weight 216.03 g/mol
SMILES CC1=C(C=CC(=C1)Br)[N+](=O)[O-]
InChIKey PAHAIHXVVJMZKU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-methyl-1-nitrobenzene (CAS: 52414-98-9)?

4-Bromo-2-methyl-1-nitrobenzene (CAS: 52414-98-9) is a crystalline compound with a molecular weight ...

Compound Q&A

How is 4-Bromo-2-methyl-1-nitrobenzene (CAS: 52414-98-9) typically synthesized?

4-Bromo-2-methyl-1-nitrobenzene (CAS: 52414-98-9) is typically synthesized by bromination of 2-methy...

Compound Q&A

What precautions should be taken when handling 4-Bromo-2-methyl-1-nitrobenzene (CAS: 52414-98-9)?

When handling 4-Bromo-2-methyl-1-nitrobenzene (CAS: 52414-98-9), it is essential to wear appropriate...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...