Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate (CAS: 171178-45-3)?

Answer

2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate
2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate is a crystalline solid with a molecular weight of approximately 258.04 g/mol. It has a low solubility in water but is soluble in organic solvents such as methanol and acetonitrile. This compound is reactive towards strong acids and bases and can undergo hydrolysis. It is stable under normal storage conditions but should be kept away from moisture and strong oxidizing agents.

About

English Name 2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate
Molecular Formula C10H13ClN2O2
Molecular Weight 228.68 g/mol
SMILES CC(C)(C)OC(=O)NC1=CN=C(C=C1)Cl
InChIKey IRHNQVINMHHEIO-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate (CAS: 171178-45-3) typically synthesized?

2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate is typically synthesized via the reaction of 2-m...

Compound Q&A

What industries use 2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate (CAS: 171178-45-3)?

2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate is primarily used in the pharmaceutical industry...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate (CAS: 171178-45-3)?

When handling 2-Methyl-2-propanyl (6-chloro-3-pyridinyl)carbamate, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...