Compound Q&A

How is 2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate (CAS: 868736-42-9) typically synthesized?

Answer

2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate
2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate (CAS: 868736-42-9) is synthesized through a multi-step process involving alkylation of a pyridine derivative followed by condensation with an amine. The reaction is typically catalyzed by a mild base, and the product is isolated through recrystallization from a suitable organic solvent.

About

English Name 2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate
Molecular Formula C11H13ClN2O3
Molecular Weight 256.69 g/mol
SMILES CC(C)(C)OC(=O)Nc1nccc(Cl)c1C=O
InChIKey QWVXQYZWGQFXPU-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate (CAS: 868736-42-9)?

2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate (CAS: 868736-42-9) is a crystalline sol...

Compound Q&A

What industries use 2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate (CAS: 868736-42-9)?

2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate (CAS: 868736-42-9) finds applications i...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate (CAS: 868736-42-9)?

When handling 2-Methyl-2-propanyl (4-chloro-3-formyl-2-pyridinyl)carbamate (CAS: 868736-42-9), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...