Compound Q&A

How should Hosenkoside M (CAS: 161016-51-9) be stored?

Answer

Hosenkoside M
Hosenkoside M (CAS: 161016-51-9) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent deterioration. The ideal storage temperature is between 5°C and 25°C (41°F to 77°F) to ensure its stability and effectiveness.

About

English Name Hosenkoside M
Molecular Formula C53H90O24
Molecular Weight 1111.28 g/mol
SMILES CC(COC1OC(CO)C(O)C(O)C1O)C1CCC2(CCC3(C)C(CCC4C5(C)CCC(OC6OC(CO)C(O)C(O)C6OC6OCC(O)C(O)C6O)C(C)(COC6OC(CO)C(O)C(O)C6O)C5CCC34C)C2O)CO1
InChIKey NACOJBQGIGOFFX-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is Hosenkoside M (CAS: 161016-51-9)?

Hosenkoside M (CAS: 161016-51-9) is a flavonoid glucoside found in various plant species. It has a m...

Compound Q&A

What are the main uses of Hosenkoside M (CAS: 161016-51-9)?

Hosenkoside M (CAS: 161016-51-9) is primarily used in the development of natural health products, di...

Compound Q&A

Is Hosenkoside M (CAS: 161016-51-9) safe?

Hosenkoside M (CAS: 161016-51-9) is considered safe for use in food and pharmaceutical products when...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...