Compound Q&A

What are the main uses of 1-(4-Chlorophenyl)cyclopentanecarboxylic acid (CAS: 80789-69-1)?

Answer

1-(4-Chlorophenyl)cyclopentanecarboxylic acid
1-(4-Chlorophenyl)cyclopentanecarboxylic acid is primarily used in pharmaceuticals as an intermediate for the synthesis of other compounds. It is also utilized in research and development for its unique chemical properties. Additionally, it has applications in the synthesis of organic compounds and materials.

About

CAS No 80789-69-1
English Name 1-(4-Chlorophenyl)cyclopentanecarboxylic acid
Molecular Formula C12H13ClO2
Molecular Weight 224.69 g/mol
SMILES OC(=O)C1(CCCC1)c2ccc(Cl)cc2
InChIKey QJNFJEMGWIQMJT-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is 1-(4-Chlorophenyl)cyclopentanecarboxylic acid (CAS: 80789-69-1)?

1-(4-Chlorophenyl)cyclopentanecarboxylic acid is a chemical compound with the CAS number 80789-69-1....

Compound Q&A

Is 1-(4-Chlorophenyl)cyclopentanecarboxylic acid (CAS: 80789-69-1) safe?

1-(4-Chlorophenyl)cyclopentanecarboxylic acid is generally considered safe when handled with appropr...

Compound Q&A

How should 1-(4-Chlorophenyl)cyclopentanecarboxylic acid (CAS: 80789-69-1) be stored?

1-(4-Chlorophenyl)cyclopentanecarboxylic acid should be stored in a cool, dry environment away from ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...