Compound Q&A

How should 2,3,5-Trichlorobenzoic acid (CAS: 50-73-7) be stored?

Answer

2,3,5-Trichlorobenzoic acid
2,3,5-Trichlorobenzoic acid should be stored in a cool, dry, well-ventilated area away from heat and sources of ignition. It should be kept in a tightly sealed container to prevent moisture absorption. Avoid exposure to light and store it away from incompatible materials such as bases, reducing agents, and alcohols.

About

CAS No 50-73-7
English Name 2,3,5-Trichlorobenzoic acid
Molecular Formula C7H3Cl3O2
Molecular Weight 225.46 g/mol
SMILES C1=C(C=C(C(=C1C(=O)O)Cl)Cl)Cl
InChIKey CGFDSIZRJWMQPP-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is 2,3,5-Trichlorobenzoic acid (CAS: 50-73-7)?

2,3,5-Trichlorobenzoic acid is a trichlorinated benzoic acid derivative. It has the chemical formula...

Compound Q&A

What are the main uses of 2,3,5-Trichlorobenzoic acid (CAS: 50-73-7)?

2,3,5-Trichlorobenzoic acid is widely used in pharmaceuticals for the synthesis of certain drugs. It...

Compound Q&A

Is 2,3,5-Trichlorobenzoic acid (CAS: 50-73-7) safe?

2,3,5-Trichlorobenzoic acid is classified as a hazardous substance due to its corrosive nature. It i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...