Related Q&A
What is (2R,5R)-2,5-Hexanediol (CAS: 17299-07-9)?
(2R,5R)-2,5-Hexanediol is an organic compound with the formula CH3CH(OH)CH2CH(OH)CH2CH3. It is a col...
What are the main uses of (2R,5R)-2,5-Hexanediol (CAS: 17299-07-9)?
(2R,5R)-2,5-Hexanediol is widely used in the pharmaceutical industry as a moisturizing agent, in cos...
Is (2R,5R)-2,5-Hexanediol (CAS: 17299-07-9) safe?
(2R,5R)-2,5-Hexanediol is generally considered safe for its intended uses. However, it should be han...
What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?
6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...
What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?
4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...
What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?
2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...
What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?
2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...



