Compound Q&A

How should 2-Chloro-5-(trifluoromethyl)nicotinic acid (CAS: 505084-59-3) be stored?

Answer

2-Chloro-5-(trifluoromethyl)nicotinic acid
2-Chloro-5-(trifluoromethyl)nicotinic acid (CAS: 505084-59-3) should be stored in a cool, dry place away from direct sunlight and heat sources. It is advisable to keep it in a tightly sealed container to prevent contamination and degradation. Refrigeration is not typically required but can be used if the product is sensitive to temperature changes.

About

English Name 2-Chloro-5-(trifluoromethyl)nicotinic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=C(C=NC(=C1C(=O)O)Cl)C(F)(F)F
InChIKey RMSKYTKOFDQVEL-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is 2-Chloro-5-(trifluoromethyl)nicotinic acid (CAS: 505084-59-3)?

2-Chloro-5-(trifluoromethyl)nicotinic acid (CAS: 505084-59-3) is a chemical compound characterized b...

Compound Q&A

What are the main uses of 2-Chloro-5-(trifluoromethyl)nicotinic acid (CAS: 505084-59-3)?

2-Chloro-5-(trifluoromethyl)nicotinic acid (CAS: 505084-59-3) is primarily used in pharmaceuticals, ...

Compound Q&A

Is 2-Chloro-5-(trifluoromethyl)nicotinic acid (CAS: 505084-59-3) safe?

2-Chloro-5-(trifluoromethyl)nicotinic acid (CAS: 505084-59-3) can be considered safe when handled wi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...