Compound Q&A

What is Methyl 3-iodo-4-methoxybenzoate (CAS: 35387-93-0)?

Answer

Methyl 3-iodo-4-methoxybenzoate
Methyl 3-iodo-4-methoxybenzoate (CAS: 35387-93-0) is an organic compound characterized by the presence of a methyl group, an iodine atom, and a methoxy group attached to a benzoic acid structure. It has a molecular formula of C9H9IO2 and is used in pharmaceuticals and research due to its unique chemical properties.

About

CAS No 35387-93-0
English Name Methyl 3-iodo-4-methoxybenzoate
Molecular Formula C9H9IO3
Molecular Weight 292.07 g/mol
SMILES COC1=C(C=C(C=C1)C(=O)OC)I
InChIKey GHNGBFHLUOJHKP-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What are the main uses of Methyl 3-iodo-4-methoxybenzoate (CAS: 35387-93-0)?

Methyl 3-iodo-4-methoxybenzoate (CAS: 35387-93-0) is primarily used in the pharmaceutical industry a...

Compound Q&A

Is Methyl 3-iodo-4-methoxybenzoate (CAS: 35387-93-0) safe?

Methyl 3-iodo-4-methoxybenzoate (CAS: 35387-93-0) is generally considered safe when handled with app...

Compound Q&A

How should Methyl 3-iodo-4-methoxybenzoate (CAS: 35387-93-0) be stored?

Methyl 3-iodo-4-methoxybenzoate (CAS: 35387-93-0) should be stored in a cool, dry place away from di...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...