Compound Q&A

What are the main uses of (3S)-3-Amino-3-(4-chlorophenyl)propanoic acid (CAS: 131690-60-3)?

Answer

(3S)-3-Amino-3-(4-chlorophenyl)propanoic acid
(3S)-3-Amino-3-(4-chlorophenyl)propanoic acid is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drugs. It has also found applications in research for its biological activity and as an intermediate in organic synthesis. Additionally, it can be used in the development of new chemical entities with potential therapeutic benefits.

About

English Name (3S)-3-Amino-3-(4-chlorophenyl)propanoic acid
Molecular Formula C9H10ClNO2
Molecular Weight 199.63699999999997 g/mol
SMILES C1=CC(=CC=C1C(CC(=O)O)N)Cl
InChIKey BXGDBHAMTMMNTO-QMMMGPOBSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is (3S)-3-Amino-3-(4-chlorophenyl)propanoic acid (CAS: 131690-60-3)?

(3S)-3-Amino-3-(4-chlorophenyl)propanoic acid, also known as 4-(3-Amino-3-(4-chlorophenyl)propyl)ben...

Compound Q&A

Is (3S)-3-Amino-3-(4-chlorophenyl)propanoic acid (CAS: 131690-60-3) safe?

(3S)-3-Amino-3-(4-chlorophenyl)propanoic acid is generally considered safe under appropriate handlin...

Compound Q&A

How should (3S)-3-Amino-3-(4-chlorophenyl)propanoic acid (CAS: 131690-60-3) be stored?

(3S)-3-Amino-3-(4-chlorophenyl)propanoic acid should be stored in a cool, dry place away from direct...

Compound Q&A

How is 1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) typically synthesized?

1-(2-Naphthyl)-1H-pyrrole-2,5-dione (CAS: 6637-45-2) can be synthesized through ...

6637-45-21-(2-Naphthyl)-1H-py...
Compound Q&A

What is Diisodecyl phthalate (CAS: 68515-49-1)?

Diisodecyl phthalate (DIDP) is a clear, colorless, and odorless liquid with a CA...

68515-49-1Diisodecyl phthalate
1189172-05-1(trans-racemic)-Meth...
Compound Q&A

What are the main uses of (Ala13)-Apelin-13 (CAS: 568565-11-7)?

(Ala13)-Apelin-13 is primarily used in research for studying the apelin receptor...

568565-11-7(Ala13)-Apelin-13 (h...