Compound Q&A

What are the main uses of (S)-2-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 19883-74-0)?

Answer

(S)-2-Amino-3-(3-nitrophenyl)propanoic acid
(S)-2-Amino-3-(3-nitrophenyl)propanoic acid is primarily used in pharmaceuticals as a building block for the synthesis of peptides and proteins. It also finds applications in chemical research for the development of organic synthesis methodologies and as a precursor in various organic transformations. Additionally, it can be used in the food industry as a flavor enhancer or in analytical chemistry as a reagent.

About

CAS No 19883-74-0
English Name (S)-2-Amino-3-(3-nitrophenyl)propanoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES C1=CC(=CC(=C1)[N+](=O)[O-])CC(C(=O)O)N
InChIKey YTHDRUZHNYKZGF-QMMMGPOBSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is (S)-2-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 19883-74-0)?

(S)-2-Amino-3-(3-nitrophenyl)propanoic acid, also known as S-(3-nitrophenyl)alanine, is an organic c...

Compound Q&A

Is (S)-2-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 19883-74-0) safe?

The safety of (S)-2-Amino-3-(3-nitrophenyl)propanoic acid depends on the exposure route and duration...

Compound Q&A

How should (S)-2-Amino-3-(3-nitrophenyl)propanoic acid (CAS: 19883-74-0) be stored?

(S)-2-Amino-3-(3-nitrophenyl)propanoic acid should be stored in a tightly closed container in a cool...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...