Compound Q&A

What is Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate] (CAS: 15632-39-0)?

Answer

Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate]
Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate] (CAS: 15632-39-0) is a complex compound of yttrium with a unique organic ligand. It has a distinctive structure comprising yttrium ions coordinated by organic ligands. This compound is known for its stability and potential use in various applications due to its chemical properties.

About

CAS No 15632-39-0
English Name Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate]
Molecular Formula C33H57O6Y
Molecular Weight 638.72 g/mol
SMILES CC(/C(=C/C(=O)C(C)(C)C)/O[Y](O/C(=C\C(=O)C(C)(C)C)/C(C)(C)C)O/C(=C\C(=O)C(C)(C)C)/C(C)(C)C)(C)C
InChIKey PPRRRPCEDUWEHL-LWTKGLMZSA-K
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What are the main uses of Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate] (CAS: 15632-39-0)?

Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate] (CAS: 15632-39-0) is primarily used in...

Compound Q&A

Is Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate] (CAS: 15632-39-0) safe?

Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate] (CAS: 15632-39-0) is generally conside...

Compound Q&A

How should Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate] (CAS: 15632-39-0) be stored?

Yttrium tris[(3Z)-2,2,6,6-tetramethyl-5-oxo-3-hepten-3-olate] (CAS: 15632-39-0) should be stored in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...