Compound Q&A

What are the main uses of 5-Chloro-2-fluorobenzenesulfonyl chloride (CAS: 351003-49-1)?

Answer

5-Chloro-2-fluorobenzenesulfonyl chloride
5-Chloro-2-fluorobenzenesulfonyl chloride (CAS: 351003-49-1) is primarily used in the synthesis of pharmaceuticals and as an intermediate in organic chemistry. It is also utilized in research and development for various chemical applications.

About

English Name 5-Chloro-2-fluorobenzenesulfonyl chloride
Molecular Formula C6H3Cl2FO2S
Molecular Weight 229.06 g/mol
SMILES C1=CC(=C(C=C1Cl)S(=O)(=O)Cl)F
InChIKey OZKAHSNNKADHTK-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is 5-Chloro-2-fluorobenzenesulfonyl chloride (CAS: 351003-49-1)?

5-Chloro-2-fluorobenzenesulfonyl chloride (CAS: 351003-49-1) is an organic compound with the molecul...

Compound Q&A

Is 5-Chloro-2-fluorobenzenesulfonyl chloride (CAS: 351003-49-1) safe?

5-Chloro-2-fluorobenzenesulfonyl chloride (CAS: 351003-49-1) is generally safe when handled with app...

Compound Q&A

How should 5-Chloro-2-fluorobenzenesulfonyl chloride (CAS: 351003-49-1) be stored?

5-Chloro-2-fluorobenzenesulfonyl chloride (CAS: 351003-49-1) should be stored in a cool, dry place a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...