Compound Q&A

What are the main uses of 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride (CAS: 65208-35-7)?

Answer

2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride
2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride (CAS: 65208-35-7) is primarily used in pharmaceutical applications for the synthesis of certain compounds. It also finds use in the chemical industry for specific reactions and in research due to its unique chemical properties.

About

CAS No 65208-35-7
English Name 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride
Molecular Formula C6F12O2
Molecular Weight 332.04 g/mol
SMILES C(=O)(C(C(F)(F)F)(OC(C(C(F)(F)F)(F)F)(F)F)F)F
InChIKey BCLQALQSEBVVAD-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride (CAS: 65208-35-7)?

2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride (CAS: 65208-35-7) is a highly fluorinat...

Compound Q&A

Is 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride (CAS: 65208-35-7) safe?

2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride (CAS: 65208-35-7) is generally safe whe...

Compound Q&A

How should 2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride (CAS: 65208-35-7) be stored?

2,3,3,3-Tetrafluoro-2-(heptafluoropropoxy)propanoyl fluoride (CAS: 65208-35-7) should be stored in a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...