Compound Q&A

What are the main uses of 1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate (CAS: 310454-53-6)?

Answer

1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate
1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate (CAS: 310454-53-6) is primarily used as a research tool and in pharmaceuticals for developing new drugs. It serves as a potential intermediate in organic synthesis and as a scaffold for drug design due to its unique chemical structure.

About

English Name 1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate
Molecular Formula C16H21NO4
Molecular Weight 291.35 g/mol
SMILES CCOC(=O)C1CCCN(C1)C(=O)OCC2=CC=CC=C2
InChIKey NJRONXOELMBCSE-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What is 1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate (CAS: 310454-53-6)?

1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate (CAS: 310454-53-6) is a chemical compound with the mole...

Compound Q&A

Is 1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate (CAS: 310454-53-6) safe?

1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate (CAS: 310454-53-6) is generally safe when handled with ...

Compound Q&A

How should 1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate (CAS: 310454-53-6) be stored?

1-Benzyl 3-ethyl 1,3-piperidinedicarboxylate (CAS: 310454-53-6) should be stored in a tightly sealed...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...