Compound Q&A

What is 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (CAS: 866545-96-2)?

Answer

1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone
1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone is an organic compound with the CAS number 866545-96-2. It is a derivative of pyrrolo[2,3-b]pyridine with a bromo substituent on the 5-position and an acetyl group attached to the nitrogen atom. This compound is known for its potential applications in pharmaceuticals and research due to its unique chemical structure.

About

English Name 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone
Molecular Formula C9H7BrN2O
Molecular Weight 239.07 g/mol
SMILES CC(=O)c1c[nH]c2ncc(Br)cc12
InChIKey AYSQNMFURHMHBB-UHFFFAOYSA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What are the main uses of 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (CAS: 866545-96-2)?

1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (CAS: 866545-96-2) is primarily used in pharmaceut...

Compound Q&A

Is 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (CAS: 866545-96-2) safe?

1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (CAS: 866545-96-2) is generally safe when handled ...

Compound Q&A

How should 1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (CAS: 866545-96-2) be stored?

1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)ethanone (CAS: 866545-96-2) should be stored in a cool, dry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...