Compound Q&A

What is 2-Acetoxybenzoic acid - L-arginine (1:1) (CAS: 37466-21-0)?

Answer

2-Acetoxybenzoic acid - L-arginine (1:1)
2-Acetoxybenzoic acid - L-arginine (1:1) is a chemical compound with the CAS number 37466-21-0. It is a complex mixture of 2-acetoxybenzoic acid and L-arginine in a 1:1 molar ratio. This compound is characterized by its acidic and amine functionalities, which contribute to its potential in various applications.

About

CAS No 37466-21-0
English Name 2-Acetoxybenzoic acid - L-arginine (1:1)
Molecular Formula C15H22N4O6
Molecular Weight 354.36 g/mol
SMILES CC(=O)OC1=CC=CC=C1C(=O)O.C(CC(C(=O)O)N)CN=C(N)N
InChIKey FXXXGQLMXDIPQA-VWMHFEHESA-N
Last Updated: 2025-10-22 00:41

Related Q&A

Compound Q&A

What are the main uses of 2-Acetoxybenzoic acid - L-arginine (1:1) (CAS: 37466-21-0)?

2-Acetoxybenzoic acid - L-arginine (1:1) is primarily used in pharmaceuticals for its potential as a...

Compound Q&A

Is 2-Acetoxybenzoic acid - L-arginine (1:1) (CAS: 37466-21-0) safe?

2-Acetoxybenzoic acid - L-arginine (1:1) is generally safe when handled with appropriate precautions...

Compound Q&A

How should 2-Acetoxybenzoic acid - L-arginine (1:1) (CAS: 37466-21-0) be stored?

2-Acetoxybenzoic acid - L-arginine (1:1) should be stored in a cool, dry place to maintain its stabi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...