Compound Q&A

What are the main uses of 1-Decyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 171058-18-7)?

Answer

1-Decyl-3-methyl-1H-imidazol-3-ium chloride
1-Decyl-3-methyl-1H-imidazol-3-ium chloride is primarily used in pharmaceuticals as a surfactant and emulsifier, enhancing the stability and efficacy of drug formulations. It is also used in cosmetics as a preservative and emulsifier. Additionally, it serves as a research reagent in various chemical and biological studies.

About

English Name 1-Decyl-3-methyl-1H-imidazol-3-ium chloride
Molecular Formula C14H27ClN2
Molecular Weight 258.83 g/mol
SMILES CCCCCCCCCCN1C=C[N+](=C1)C.[Cl-]
InChIKey HTZVLLVRJHAJJF-UHFFFAOYSA-M
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is 1-Decyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 171058-18-7)?

1-Decyl-3-methyl-1H-imidazol-3-ium chloride is a quaternary ammonium compound with the CAS number 17...

Compound Q&A

Is 1-Decyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 171058-18-7) safe?

1-Decyl-3-methyl-1H-imidazol-3-ium chloride is generally considered safe for industrial and pharmace...

Compound Q&A

How should 1-Decyl-3-methyl-1H-imidazol-3-ium chloride (CAS: 171058-18-7) be stored?

1-Decyl-3-methyl-1H-imidazol-3-ium chloride should be stored in a cool, dry place with a maximum tem...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...