Compound Q&A

Is (2S,5R)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide (CAS: 76646-91-8) safe?

Answer

(2S,5R)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide
This compound should be handled with caution due to its chemical properties, including potential reactivity and toxicity. Proper safety measures, such as the use of appropriate personal protective equipment and ventilation, are recommended to ensure safety during handling and storage.

About

CAS No 76646-91-8
English Name (2S,5R)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide
Molecular Formula C8H9Br2NO5S
Molecular Weight 391.04 g/mol
SMILES CC1(C(N2C(S1(=O)=O)C(C2=O)(Br)Br)C(=O)O)C
InChIKey DZYBRGUNKNPEKM-BBIVZNJYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is (2S,5R)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide (CAS: 76646-91-8)?

This compound is a dibromo derivative of a specific azabicyclic carboxylic acid. It is characterized...

Compound Q&A

What are the main uses of (2S,5R)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide (CAS: 76646-91-8)?

This compound is primarily used in pharmaceutical and research applications due to its unique chemic...

Compound Q&A

How should (2S,5R)-6,6-Dibromo-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid 4,4-dioxide (CAS: 76646-91-8) be stored?

This compound should be stored in a cool, dry place, away from direct sunlight and sources of heat. ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...