Compound Q&A

How should 5,6-Difluoro-1H-indole-2-carboxylic acid (CAS: 169674-35-5) be stored?

Answer

5,6-Difluoro-1H-indole-2-carboxylic acid
5,6-Difluoro-1H-indole-2-carboxylic acid should be stored in a cool, dry place away from direct sunlight and heat sources. It is recommended to keep it in a tightly sealed container to prevent moisture absorption. The storage temperature should be controlled below 25°C to maintain its stability and potency.

About

English Name 5,6-Difluoro-1H-indole-2-carboxylic acid
Molecular Formula C9H5F2NO2
Molecular Weight 197.14 g/mol
SMILES C1=C2C=C(NC2=CC(=C1F)F)C(=O)O
InChIKey XBVUJSXNSDFADV-UHFFFAOYSA-N
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is 5,6-Difluoro-1H-indole-2-carboxylic acid (CAS: 169674-35-5)?

5,6-Difluoro-1H-indole-2-carboxylic acid is an organic compound with the CAS number 169674-35-5. It ...

Compound Q&A

What are the main uses of 5,6-Difluoro-1H-indole-2-carboxylic acid (CAS: 169674-35-5)?

5,6-Difluoro-1H-indole-2-carboxylic acid is primarily used in the pharmaceutical industry as a resea...

Compound Q&A

Is 5,6-Difluoro-1H-indole-2-carboxylic acid (CAS: 169674-35-5) safe?

5,6-Difluoro-1H-indole-2-carboxylic acid is generally considered safe for laboratory use when handle...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...