Compound Q&A

How should Dipotassium hexachloroosmate(2-) (CAS: 16871-60-6) be stored?

Answer

Dipotassium hexachloroosmate(2-)
Dipotassium hexachloroosmate(2-) (CAS: 16871-60-6) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture absorption. Proper storage helps maintain its stability and prevents degradation, ensuring safe handling and use.

About

CAS No 16871-60-6
English Name Dipotassium hexachloroosmate(2-)
Molecular Formula Cl6K2Os
Molecular Weight 481.14 g/mol
EINECS 240-893-6
SMILES Cl[Os-2](Cl)(Cl)(Cl)(Cl)Cl.[K+].[K+]
InChIKey VGKQJCSDERXWRV-UHFFFAOYSA-H
Last Updated: 2025-10-21 21:33

Related Q&A

Compound Q&A

What is Dipotassium hexachloroosmate(2-) (CAS: 16871-60-6)?

Dipotassium hexachloroosmate(2-) (CAS: 16871-60-6) is a chemical compound with the formula K2[OsCl6]...

Compound Q&A

What are the main uses of Dipotassium hexachloroosmate(2-) (CAS: 16871-60-6)?

Dipotassium hexachloroosmate(2-) (CAS: 16871-60-6) is primarily used in analytical chemistry as a re...

Compound Q&A

Is Dipotassium hexachloroosmate(2-) (CAS: 16871-60-6) safe?

Dipotassium hexachloroosmate(2-) (CAS: 16871-60-6) is generally considered safe when handled with ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...